EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClN5O4 |
| Net Charge | 0 |
| Average Mass | 301.690 |
| Monoisotopic Mass | 301.05778 |
| SMILES | Nc1ncnc2c1nc(Cl)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12ClN5O4/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,13,14)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | MHDPPLULTMGBSI-UUOKFMHZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-chloroadenosine (CHEBI:757885) has role antineoplastic agent (CHEBI:35610) |
| 8-chloroadenosine (CHEBI:757885) is a purine nucleoside (CHEBI:26394) |
| Synonyms | Source |
|---|---|
| 8-chloroadenosine | ChEMBL |
| NSC-354258 | ChEMBL |
| Citations |
|---|