EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757873 - umifoxolaner
| Formula | C26H16ClF10N3O3 |
| Net Charge | 0 |
| Average Mass | 643.865 |
| Monoisotopic Mass | 643.07205 |
| SMILES | O=C(CNC(=O)c1ccc(C2=NO[C@@](c3cc(Cl)c(F)c(C(F)(F)F)c3)(C(F)(F)F)C2)c2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C26H16ClF10N3O3/c27-18-8-12(7-17(21(18)28)25(32,33)34)23(26(35,36)37)9-19(40-43-23)15-5-6-16(14-4-2-1-3-13(14)15)22(42)38-10-20(41)39-11-24(29,30)31/h1-8H,9-11H2,(H,38,42)(H,39,41)/t23-/m0/s1 |
| InChIKey | TVYPNAKLSTUPJB-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| umifoxolaner (CHEBI:757873) has role antiparasitic agent (CHEBI:35442) |
| umifoxolaner (CHEBI:757873) is a naphthoic acid (CHEBI:25483) |
| Synonyms | Source |
|---|---|
| ML-878 | ChEMBL |
| ML878 | ChEMBL |
| Umifoxolaner | ChEMBL |