EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10D8N6 |
| Net Charge | 0 |
| Average Mass | 314.422 |
| Monoisotopic Mass | 314.20951 |
| SMILES | [2H]C1([2H])C([C@@H](CC#N)n2cc(-c3ncnc4nccc34)cn2)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C17H18N6/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16/h6,8-12,15H,1-5H2,(H,19,20,21)/t15-/m1/s1/i1D2,2D2,3D2,4D2 |
| InChIKey | HFNKQEVNSGCOJV-FBXGHSCESA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deuruxolitinib (CHEBI:757870) has role renoprotective agent (CHEBI:231911) |
| deuruxolitinib (CHEBI:757870) is a pyrrolopyrimidine (CHEBI:38670) |
| INN | Source |
|---|---|
| deuruxolitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| C-21543 | ChEMBL |
| CTP-543 | ChEMBL |
| D8-ruxolitinib | ChEMBL |