EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClD4N5O2 |
| Net Charge | 0 |
| Average Mass | 429.944 |
| Monoisotopic Mass | 429.18696 |
| SMILES | [2H]c1c([2H])c([2H])c2c(nc(=O)n2CCCN2CCC(n3c(=O)nc4cc(Cl)ccc43)CC2)c1[2H] |
| InChI | InChI=1S/C22H24ClN5O2/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30)/i1D,2D,4D,5D |
| InChIKey | FGXWKSZFVQUSTL-GYABSUSNSA-N |
| Roles Classification |
|---|
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deudomperidone (CHEBI:757869) has role gastrointestinal drug (CHEBI:55324) |
| deudomperidone (CHEBI:757869) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| deudomperidone | WHO MedNet |
| Synonym | Source |
|---|---|
| CIN-102 | ChEMBL |