EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N4O2 |
| Net Charge | 0 |
| Average Mass | 314.389 |
| Monoisotopic Mass | 314.17428 |
| SMILES | CCc1nnc(C(=O)Nc2ccc([C@H]3CNCCO3)cc2)c1C |
| InChI | InChI=1S/C17H22N4O2/c1-3-14-11(2)16(21-20-14)17(22)19-13-6-4-12(5-7-13)15-10-18-8-9-23-15/h4-7,15,18H,3,8-10H2,1-2H3,(H,19,22)(H,20,21)/t15-/m1/s1 |
| InChIKey | XHHXGKRFUPEPFM-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ralmitaront (CHEBI:757866) has role antipsychotic agent (CHEBI:35476) |
| ralmitaront (CHEBI:757866) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| ralmitaront | WHO MedNet |
| Synonyms | Source |
|---|---|
| RG-7906 | ChEMBL |
| RG7906 | ChEMBL |
| RO-6889450 | ChEMBL |
| RO6889450 | ChEMBL |