EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H39NO11 |
| Net Charge | 0 |
| Average Mass | 649.693 |
| Monoisotopic Mass | 649.25231 |
| SMILES | CC(=O)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C35H39NO11/c1-18(39)36-12-10-35(11-13-36)23-14-19(4-8-25-29(40)33(44)31(42)27(16-37)46-25)2-6-21(23)22-7-3-20(15-24(22)35)5-9-26-30(41)34(45)32(43)28(17-38)47-26/h2-3,6-7,14-15,25-34,37-38,40-45H,10-13,16-17H2,1H3/t25-,26-,27-,28-,29-,30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | SFHMWDMKUYVSQJ-VECBPBMLSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sibofimloc (CHEBI:757805) is a fluorenes (CHEBI:24059) |
| INN | Source |
|---|---|
| sibofimloc | WHO MedNet |
| Synonyms | Source |
|---|---|
| EB-8018 | ChEMBL |
| EB8018 | ChEMBL |
| Tak-018 | ChEMBL |
| TAK018 | ChEMBL |
| VRT-1353385 | ChEMBL |