EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20F3N5O4S |
| Net Charge | 0 |
| Average Mass | 435.428 |
| Monoisotopic Mass | 435.11881 |
| SMILES | Cn1cc(S(=O)(=O)[C@@](C)(F)C2CCN(C(=O)Nc3ccon3)CC2)c(C(F)F)n1 |
| InChI | InChI=1S/C16H20F3N5O4S/c1-16(19,29(26,27)11-9-23(2)21-13(11)14(17)18)10-3-6-24(7-4-10)15(25)20-12-5-8-28-22-12/h5,8-10,14H,3-4,6-7H2,1-2H3,(H,20,22,25)/t16-/m1/s1 |
| InChIKey | NREKKBAMVWQRES-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danicamtiv (CHEBI:757804) has role cardiovascular drug (CHEBI:35554) |
| danicamtiv (CHEBI:757804) is a piperidinecarboxamide (CHEBI:48592) |
| INN | Source |
|---|---|
| danicamtiv | WHO MedNet |
| Synonyms | Source |
|---|---|
| MYK-491 | ChEMBL |
| MYK491 | ChEMBL |
| SAR-440181 | ChEMBL |
| SAR440181 | ChEMBL |