EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.H2O.C38H36N6O7 |
| Net Charge | 0 |
| Average Mass | 802.863 |
| Monoisotopic Mass | 802.26323 |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(-n3nnc(-c4cc(OC)c(OC)cc4NC(=O)c4cc(=O)c5ccccc5o4)n3)cc1)CC2.CS(=O)(=O)O.O |
| InChI | InChI=1S/C38H36N6O7.CH4O3S.H2O/c1-47-32-17-24-14-16-43(22-25(24)18-33(32)48-2)15-13-23-9-11-26(12-10-23)44-41-37(40-42-44)28-19-34(49-3)35(50-4)20-29(28)39-38(46)36-21-30(45)27-7-5-6-8-31(27)51-36;1-5(2,3)4;/h5-12,17-21H,13-16,22H2,1-4H3,(H,39,46);1H3,(H,2,3,4);1H2 |
| InChIKey | DGJLRUWQERZYGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| encequidar mesylate (CHEBI:757801) has role antineoplastic agent (CHEBI:35610) |
| encequidar mesylate (CHEBI:757801) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| Encequidar mesylate | ChEMBL |
| Encequidar mesylate anhydrous | ChEMBL |
| Encequidar mesylate monohydrate | ChEMBL |
| FM0F74 | ChEMBL |
| HM-30181A | ChEMBL |
| HM30181A | ChEMBL |
| Brand Name | Source |
|---|---|
| Encequidar mesylate component of oraxol hm-30181a | ChEMBL |