EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C26H23N7O2 |
| Net Charge | 0 |
| Average Mass | 581.589 |
| Monoisotopic Mass | 581.20228 |
| SMILES | CC#CC(=O)N1CCC[C@H]1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c2c(N)nccn12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H23N7O2.C4H4O4/c1-2-6-21(34)32-15-5-7-19(32)25-31-22(23-24(27)29-14-16-33(23)25)17-9-11-18(12-10-17)26(35)30-20-8-3-4-13-28-20;5-3(6)1-2-4(7)8/h3-4,8-14,16,19H,5,7,15H2,1H3,(H2,27,29)(H,28,30,35);1-2H,(H,5,6)(H,7,8)/b;2-1-/t19-;/m0./s1 |
| InChIKey | JWEQLWMZHJSMEC-AFJTUFCWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acalabrutinib maleate (CHEBI:757795) has role antineoplastic agent (CHEBI:35610) |
| acalabrutinib maleate (CHEBI:757795) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| Acalabrutinib maleate | ChEMBL |
| Acalabrutinib maleate anhydrous | ChEMBL |
| Acalabrutinib maleate monohydrate | ChEMBL |
| Calquence maleate | ChEMBL |