EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C29H28N6O2.HCl |
| Net Charge | 0 |
| Average Mass | 547.059 |
| Monoisotopic Mass | 546.21462 |
| SMILES | CN1CCC(COc2cnc(-c3cccc(Cn4nc(-c5cccc(C#N)c5)ccc4=O)c3)nc2)CC1.Cl.O |
| InChI | InChI=1S/C29H28N6O2.ClH.H2O/c1-34-12-10-21(11-13-34)20-37-26-17-31-29(32-18-26)25-7-3-5-23(15-25)19-35-28(36)9-8-27(33-35)24-6-2-4-22(14-24)16-30;;/h2-9,14-15,17-18,21H,10-13,19-20H2,1H3;1H;1H2 |
| InChIKey | KZVOMLRKFJUTLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tepotinib hydrochloride (CHEBI:757794) has role antineoplastic agent (CHEBI:35610) |
| tepotinib hydrochloride (CHEBI:757794) is a pyridazines (CHEBI:37921) |
| tepotinib hydrochloride (CHEBI:757794) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| MSC2156119J | ChEMBL |
| Tepotinib hydrochloride | ChEMBL |
| Tepotinib hydrochloride hydrate | ChEMBL |
| Tepotinib hydrochloride monohydrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Tepmetko | ChEMBL |