EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H28BN3O5.HCl |
| Net Charge | 0 |
| Average Mass | 462.183 |
| Monoisotopic Mass | 461.16556 |
| SMILES | Cl.Cl.NCCNC1CCC(CC(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C19H28BN3O5.2ClH/c21-8-9-22-14-6-4-12(5-7-14)10-17(24)23-16-11-13-2-1-3-15(19(25)26)18(13)28-20(16)27;;/h1-3,12,14,16,22,27H,4-11,21H2,(H,23,24)(H,25,26);2*1H/t12?,14?,16-;;/m0../s1 |
| InChIKey | CKWIMFZHNCBHIX-PPJOBQAPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taniborbactam hydrochloride (CHEBI:757793) has role antibacterial agent (CHEBI:33282) |
| taniborbactam hydrochloride (CHEBI:757793) is a aromatic carboxylic acid (CHEBI:33859) |
| taniborbactam hydrochloride (CHEBI:757793) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| Taniborbactam dihydrochloride | ChEMBL |
| Taniborbactam hydrochloride | ChEMBL |
| Vnrx5133 dihydrochloride | ChEMBL |
| VNRX-5133 DIHYDROCHLORIDE | ChEMBL |
| VNRX-5133 hydrochloride | ChEMBL |