EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C20H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 524.954 |
| Monoisotopic Mass | 524.15616 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)[C@@H]1c1ccccc1Cl.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H25ClN2O5.C4H4O4/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;5-3(6)1-2-4(7)8/h5-8,17,23H,4,9-11,22H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t17-;/m0./s1 |
| InChIKey | TZNOWAJJWCGILX-HNUXRKMMSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levamlodipine maleate (CHEBI:757791) has functional parent tetracarboxylic acid (CHEBI:35742) |
| levamlodipine maleate (CHEBI:757791) has role antihypertensive agent (CHEBI:35674) |
| levamlodipine maleate (CHEBI:757791) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Amlodipine maleate, s- | ChEMBL |
| Levamlodipine maleate | ChEMBL |
| Brand Name | Source |
|---|---|
| Conjupri | ChEMBL |