EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31N5O4 |
| Net Charge | 0 |
| Average Mass | 477.565 |
| Monoisotopic Mass | 477.23760 |
| SMILES | COc1cc2c(cc1OC)-c1c/c(=N\c3c(C)cc(C)cc3C)n(CCNC(N)=O)c(=O)n1CC2 |
| InChI | InChI=1S/C26H31N5O4/c1-15-10-16(2)24(17(3)11-15)29-23-14-20-19-13-22(35-5)21(34-4)12-18(19)6-8-30(20)26(33)31(23)9-7-28-25(27)32/h10-14H,6-9H2,1-5H3,(H3,27,28,32)/b29-23+ |
| InChIKey | CSOBIBXVIYAXFM-BYNJWEBRSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ensifentrine (CHEBI:757790) has role anti-asthmatic agent (CHEBI:65023) |
| ensifentrine (CHEBI:757790) has role antiviral agent (CHEBI:22587) |
| ensifentrine (CHEBI:757790) is a pyridopyrimidine (CHEBI:38932) |
| INN | Source |
|---|---|
| ensifentrina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ensifentrine | ChEMBL |
| Ls-193,855 | ChEMBL |
| Ls-193855 | ChEMBL |
| RPL-554 | ChEMBL |
| RPL554 | ChEMBL |
| Brand Name | Source |
|---|---|
| Ohtuvayre | ChEMBL |
| Citations |
|---|