EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C24H30ClN7O2S.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 816.243 |
| Monoisotopic Mass | 815.21990 |
| SMILES | CN1CCN(Cc2ccc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)N(C)C)n3)cc2)CC1.O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C24H30ClN7O2S.2C4H6O6/c1-30(2)35(33,34)22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32;2*5-1(3(7)8)2(6)4(9)10/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29);2*1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ITRNHQKFTJNXTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dubermatinib tartrate (CHEBI:757784) has functional parent tetracarboxylic acid (CHEBI:35742) |
| dubermatinib tartrate (CHEBI:757784) has role antineoplastic agent (CHEBI:35610) |
| dubermatinib tartrate (CHEBI:757784) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Dubermatinib ditartrate | ChEMBL |
| Dubermatinib tartrate | ChEMBL |
| TP-0903 ditartrate | ChEMBL |
| TP0903 ditartrate | ChEMBL |
| TP-0903 tartrate | ChEMBL |
| TP0903 tartrate | ChEMBL |