EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23O2 |
| Net Charge | 0 |
| Average Mass | 289.381 |
| Monoisotopic Mass | 289.17074 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H]([18F])C[C@@]21[H] |
| InChI | InChI=1S/C18H23FO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1/i19-1 |
| InChIKey | KDLLNMRYZGUVMA-ZYMZXAKXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoroestradiol f-18 (CHEBI:757767) has role antineoplastic agent (CHEBI:35610) |
| fluoroestradiol f-18 (CHEBI:757767) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 16.alpha.-(18f)fluoroestradiol | ChEMBL |
| (18f)-fes | ChEMBL |
| F-18 16 alpha-fluoroestradiol | ChEMBL |
| F-18 16-alpha-fluoroestradiol | ChEMBL |
| F-18 fes | ChEMBL |
| Fes f-18 | ChEMBL |
| Brand Name | Source |
|---|---|
| Cerianna | ChEMBL |