EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20FN5O |
| Net Charge | 0 |
| Average Mass | 293.346 |
| Monoisotopic Mass | 293.16519 |
| SMILES | CCCC[C@](C)(CO)Nc1nc(N)nc2cc(F)cnc12 |
| InChI | InChI=1S/C14H20FN5O/c1-3-4-5-14(2,8-21)20-12-11-10(18-13(16)19-12)6-9(15)7-17-11/h6-7,21H,3-5,8H2,1-2H3,(H3,16,18,19,20)/t14-/m1/s1 |
| InChIKey | HTCJUBZBSJQWBW-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selgantolimod (CHEBI:757764) has role anti-HBV agent (CHEBI:64951) |
| selgantolimod (CHEBI:757764) is a pyridopyrimidine (CHEBI:38932) |
| INN | Source |
|---|---|
| selgantolimod | WHO MedNet |
| Synonym | Source |
|---|---|
| GS-9688 | ChEMBL |
| Citations |
|---|