EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27NO7S3 |
| Net Charge | 0 |
| Average Mass | 477.626 |
| Monoisotopic Mass | 477.09497 |
| SMILES | [H][C@]12SC(S[C@H]3CC[S+]([O-])C3)=C(C(=O)OCOC(=O)C(CC)CC)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C19H27NO7S3/c1-4-11(5-2)17(23)26-9-27-18(24)14-19(28-12-6-7-30(25)8-12)29-16-13(10(3)21)15(22)20(14)16/h10-13,16,21H,4-9H2,1-3H3/t10-,12+,13+,16-,30?/m1/s1 |
| InChIKey | NBPVNGWRLGHULH-JKOUTOBWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulopenem etzadroxil (CHEBI:757755) has role antiinfective agent (CHEBI:35441) |
| sulopenem etzadroxil (CHEBI:757755) has role antimicrobial agent (CHEBI:33281) |
| sulopenem etzadroxil (CHEBI:757755) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| PF-03709270 | ChEMBL |
| PF03709270 | ChEMBL |
| Sulopenem etzadroxil | ChEMBL |
| Brand Name | Source |
|---|---|
| Sulopenem etzadroxil component of orlynvah | ChEMBL |