EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17NO5.C7H17NO5.C26H26I6N2O10 |
| Net Charge | 0 |
| Average Mass | 1678.352 |
| Monoisotopic Mass | 1677.80693 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(CCOCCOCCOCCOCCC(=O)Nc1c(I)cc(I)c(C(=O)O)c1I)Nc1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C26H26I6N2O10.2C7H17NO5/c27-13-11-15(29)23(21(31)19(13)25(37)38)33-17(35)1-3-41-5-7-43-9-10-44-8-6-42-4-2-18(36)34-24-16(30)12-14(28)20(22(24)32)26(39)40;2*1-8-2-4(10)6(12)7(13)5(11)3-9/h11-12H,1-10H2,(H,33,35)(H,34,36)(H,37,38)(H,39,40);2*4-13H,2-3H2,1H3/t;2*4-,5+,6+,7+/m.00/s1 |
| InChIKey | LNBGFESBSAEKAE-VRWDCWMNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodoxamate meglumine (CHEBI:757745) is a amidobenzoic acid (CHEBI:48470) |
| Synonym | Source |
|---|---|
| Meglumine iodoxamate | ChEMBL |
| Brand Name | Source |
|---|---|
| Cholovue | ChEMBL |