EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757731 - navacaprant
| Formula | C25H32FN5O2 |
| Net Charge | 0 |
| Average Mass | 453.562 |
| Monoisotopic Mass | 453.25400 |
| SMILES | CCc1cc(F)c2nc(N3CCC(NC4CCOCC4)CC3)c(-c3nc(C)no3)c(C)c2c1 |
| InChI | InChI=1S/C25H32FN5O2/c1-4-17-13-20-15(2)22(25-27-16(3)30-33-25)24(29-23(20)21(26)14-17)31-9-5-18(6-10-31)28-19-7-11-32-12-8-19/h13-14,18-19,28H,4-12H2,1-3H3 |
| InChIKey | CQOJHAJWCDJEAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| navacaprant (CHEBI:757731) has role antidepressant (CHEBI:35469) |
| navacaprant (CHEBI:757731) is a aminoquinoline (CHEBI:36709) |
| INN | Source |
|---|---|
| navacaprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| BTRX-140 | ChEMBL |
| BTRX-335140 | ChEMBL |
| BTRX335140 | ChEMBL |
| CYM-53093 | ChEMBL |
| CYM53093 | ChEMBL |
| NMRA-140 | ChEMBL |
| Citations |
|---|