EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12F3NO4S |
| Net Charge | 0 |
| Average Mass | 383.347 |
| Monoisotopic Mass | 383.04391 |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1[C@H](O)[C@H](F)[C@@H]2F |
| InChI | InChI=1S/C17H12F3NO4S/c1-26(23,24)12-3-2-11(13-14(12)17(22)16(20)15(13)19)25-10-5-8(7-21)4-9(18)6-10/h2-6,15-17,22H,1H3/t15-,16-,17+/m1/s1 |
| InChIKey | LOMMPXLFBTZENJ-ZACQAIPSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| belzutifan (CHEBI:757730) has role antineoplastic agent (CHEBI:35610) |
| belzutifan (CHEBI:757730) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Belzutifan | ChEMBL |
| MK-6482 | ChEMBL |
| MK6482 | ChEMBL |
| Pt 2977 | ChEMBL |
| PT-2977 | ChEMBL |
| PT2977 | ChEMBL |
| Brand Name | Source |
|---|---|
| Welireg | ChEMBL |
| Citations |
|---|