EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32FN9O2 |
| Net Charge | 0 |
| Average Mass | 533.612 |
| Monoisotopic Mass | 533.26630 |
| SMILES | CO[C@]1(C(=O)N[C@@H](C)c2ccc(-n3cc(F)cn3)nc2)CC[C@H](c2nc(C)cc(Nc3cc(C)nn3)n2)CC1 |
| InChI | InChI=1S/C27H32FN9O2/c1-16-11-22(33-23-12-17(2)35-36-23)34-25(31-16)19-7-9-27(39-4,10-8-19)26(38)32-18(3)20-5-6-24(29-13-20)37-15-21(28)14-30-37/h5-6,11-15,18-19H,7-10H2,1-4H3,(H,32,38)(H2,31,33,34,35,36)/t18-,19-,27+/m0/s1 |
| InChIKey | GBLBJPZSROAGMF-RWYJCYHVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralsetinib (CHEBI:757728) has role antineoplastic agent (CHEBI:35610) |
| pralsetinib (CHEBI:757728) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| BLU-123244 | ChEMBL |
| BLU123244 | ChEMBL |
| BLU-667 | ChEMBL |
| Cis-pralsetinib | ChEMBL |
| :pralsetinib | ChEMBL |
| Pralsetinib | ChEMBL |
| Brand Name | Source |
|---|---|
| Gavreto | ChEMBL |
| Citations |
|---|