EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N9O2 |
| Net Charge | 0 |
| Average Mass | 489.584 |
| Monoisotopic Mass | 489.26007 |
| SMILES | COc1nn(C)cc1Nc1nccc(-c2cnc3c(NC(=O)[C@@H](C)N4CCN(C)CC4)cccc23)n1 |
| InChI | InChI=1S/C25H31N9O2/c1-16(34-12-10-32(2)11-13-34)23(35)28-20-7-5-6-17-18(14-27-22(17)20)19-8-9-26-25(29-19)30-21-15-33(3)31-24(21)36-4/h5-9,14-16,27H,10-13H2,1-4H3,(H,28,35)(H,26,29,30)/t16-/m1/s1 |
| InChIKey | CVCVOSPZEVINRM-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| golidocitinib (CHEBI:757725) has role antineoplastic agent (CHEBI:35610) |
| golidocitinib (CHEBI:757725) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| golidocitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD-4205 | ChEMBL |
| AZD4205 | ChEMBL |
| AZD4205 free base | ChEMBL |
| Citations |
|---|