EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37FN6O5S |
| Net Charge | 0 |
| Average Mass | 588.706 |
| Monoisotopic Mass | 588.25302 |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(CN4CCC(C(C)(C)O)CC4)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C28H37FN6O5S/c1-28(2,36)20-5-7-34(8-6-20)17-19-13-21(29)15-22-24(31-27(32-25(19)22)35-9-11-40-12-10-35)18-14-23(33-41(4,37)38)26(39-3)30-16-18/h13-16,20,33,36H,5-12,17H2,1-4H3 |
| InChIKey | NVWKNQGHVMMAJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linperlisib (CHEBI:757724) has role anti-anaemic agent (CHEBI:75835) |
| linperlisib (CHEBI:757724) has role antineoplastic agent (CHEBI:35610) |
| linperlisib (CHEBI:757724) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Linperlisib | ChEMBL |
| PI3K.DELTA.-IN-2 | ChEMBL |
| Citations |
|---|