EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20Cl2N6O2 |
| Net Charge | 0 |
| Average Mass | 423.304 |
| Monoisotopic Mass | 422.10248 |
| SMILES | O=c1nc(NCc2ccc(Cl)c(Cl)c2)nc2ncn(CCN3CCOCC3)c12 |
| InChI | InChI=1S/C18H20Cl2N6O2/c19-13-2-1-12(9-14(13)20)10-21-18-23-16-15(17(27)24-18)26(11-22-16)4-3-25-5-7-28-8-6-25/h1-2,9,11H,3-8,10H2,(H2,21,23,24,27) |
| InChIKey | DEGSGBKTODESHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibezapolstat (CHEBI:757723) has role antibacterial agent (CHEBI:33282) |
| ibezapolstat (CHEBI:757723) is a oxopurine (CHEBI:25810) |
| INN | Source |
|---|---|
| ibezapolstat | WHO MedNet |
| Synonym | Source |
|---|---|
| ACX-362E | ChEMBL |
| Citations |
|---|