EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15ClN2O2 |
| Net Charge | 0 |
| Average Mass | 374.827 |
| Monoisotopic Mass | 374.08221 |
| SMILES | O=C1N[C@H](c2cncc(C#Cc3ccccc3)c2)[C@@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C22H15ClN2O2/c23-19-9-5-4-8-18(19)21-20(25-22(26)27-21)17-12-16(13-24-14-17)11-10-15-6-2-1-3-7-15/h1-9,12-14,20-21H,(H,25,26)/t20-,21-/m1/s1 |
| InChIKey | IAYVUQJOKDFLAL-NHCUHLMSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-984923 (CHEBI:757722) is a diarylheptanoid (CHEBI:78802) |
| Synonyms | Source |
|---|---|
| BMS-984923 | ChEMBL |
| BMS984923 | ChEMBL |
| Citations |
|---|