EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757718 - gsk-3186899
| Formula | C19H28F3N7O3S |
| Net Charge | 0 |
| Average Mass | 491.540 |
| Monoisotopic Mass | 491.19264 |
| SMILES | C[C@H]1CN(c2nnc3nc(N[C@H]4CC[C@H](NS(=O)(=O)CCC(F)(F)F)CC4)ncc23)CCO1 |
| InChI | InChI=1S/C19H28F3N7O3S/c1-12-11-29(7-8-32-12)17-15-10-23-18(25-16(15)26-27-17)24-13-2-4-14(5-3-13)28-33(30,31)9-6-19(20,21)22/h10,12-14,28H,2-9,11H2,1H3,(H2,23,24,25,26,27)/t12-,13-,14-/m0/s1 |
| InChIKey | RQWCISVRFNZHMJ-IHRRRGAJSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-3186899 (CHEBI:757718) has role antileishmanial agent (CHEBI:70868) |
| gsk-3186899 (CHEBI:757718) is a pyrazolopyrimidine (CHEBI:38669) |
| Synonyms | Source |
|---|---|
| DDD-853651 | ChEMBL |
| DDD853651 | ChEMBL |
| Gsk-3186899 | ChEMBL |
| Gsk3186899 | ChEMBL |
| GSK3186899A | ChEMBL |
| Citations |
|---|