EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31N7O3 |
| Net Charge | 0 |
| Average Mass | 525.613 |
| Monoisotopic Mass | 525.24884 |
| SMILES | COc1ccc(CN2C3CC2CN(c2ccc(-c4cc(OCC(C)(C)O)cn5ncc(C#N)c45)cn2)C3)cn1 |
| InChI | InChI=1S/C29H31N7O3/c1-29(2,37)18-39-24-9-25(28-21(10-30)13-33-36(28)17-24)20-5-6-26(31-12-20)34-15-22-8-23(16-34)35(22)14-19-4-7-27(38-3)32-11-19/h4-7,9,11-13,17,22-23,37H,8,14-16,18H2,1-3H3 |
| InChIKey | XIIOFHFUYBLOLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selpercatinib (CHEBI:757714) has role antineoplastic agent (CHEBI:35610) |
| selpercatinib (CHEBI:757714) is a piperazines (CHEBI:26144) |
| selpercatinib (CHEBI:757714) is a pyridines (CHEBI:26421) |
| Synonyms | Source |
|---|---|
| LOXO-292 | ChEMBL |
| LY-3527723 | ChEMBL |
| LY3527723 | ChEMBL |
| Ret inhibitor loxo-292 | ChEMBL |
| Selpercatinib | ChEMBL |
| Brand Names | Source |
|---|---|
| Retevmo | ChEMBL |
| Retsevmo | ChEMBL |
| Citations |
|---|