EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N8O3 |
| Net Charge | 0 |
| Average Mass | 554.655 |
| Monoisotopic Mass | 554.27539 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3cc(CN(C)C)c(-c4ccccc4)n3)n2)c(OC)cc1N1CCOCC1 |
| InChI | InChI=1S/C30H34N8O3/c1-5-28(39)32-23-17-24(26(40-4)18-25(23)37-13-15-41-16-14-37)33-30-31-12-11-27(34-30)38-20-22(19-36(2)3)29(35-38)21-9-7-6-8-10-21/h5-12,17-18,20H,1,13-16,19H2,2-4H3,(H,32,39)(H,31,33,34) |
| InChIKey | RRMJMHOQSALEJJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lazertinib (CHEBI:757712) has role antineoplastic agent (CHEBI:35610) |
| lazertinib (CHEBI:757712) is a morpholines (CHEBI:38785) |
| Synonyms | Source |
|---|---|
| C-18112003-G | ChEMBL |
| GNS-1480 | ChEMBL |
| GNS1480 | ChEMBL |
| JNJ-73841937-AAA | ChEMBL |
| Lazertinib | ChEMBL |
| YH-25448 | ChEMBL |
| Citations |
|---|