EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25BrN6O2 |
| Net Charge | 0 |
| Average Mass | 521.419 |
| Monoisotopic Mass | 520.12224 |
| SMILES | CN1CCC(Nc2nc(Nc3ccc(Oc4ccccc4)cc3)c3c(=O)ncc(Br)c3n2)CC1 |
| InChI | InChI=1S/C25H25BrN6O2/c1-32-13-11-17(12-14-32)29-25-30-22-20(26)15-27-24(33)21(22)23(31-25)28-16-7-9-19(10-8-16)34-18-5-3-2-4-6-18/h2-10,15,17H,11-14H2,1H3,(H,27,33)(H2,28,29,30,31) |
| InChIKey | SXWMIXPJPNCXQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| denfivontinib (CHEBI:757708) has role antineoplastic agent (CHEBI:35610) |
| denfivontinib (CHEBI:757708) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| denfivontinib | WHO MedNet |
| Synonym | Source |
|---|---|
| G-749 | ChEMBL |
| Citations |
|---|