EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N5O7S |
| Net Charge | 0 |
| Average Mass | 391.406 |
| Monoisotopic Mass | 391.11617 |
| SMILES | [H][C@@]12CC[C@@H](C(=O)NNC(=O)[C@@H]3CCCNC3)N(C1)C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H21N5O7S/c19-11(8-2-1-5-14-6-8)15-16-12(20)10-4-3-9-7-17(10)13(21)18(9)25-26(22,23)24/h8-10,14H,1-7H2,(H,15,19)(H,16,20)(H,22,23,24)/t8-,9-,10+/m1/s1 |
| InChIKey | YCZPXRQPDCXTIO-BBBLOLIVSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zidebactam (CHEBI:757705) has role antibacterial agent (CHEBI:33282) |
| zidebactam (CHEBI:757705) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| zidebactam | WHO MedNet |
| Synonyms | Source |
|---|---|
| WCK 5107 | ChEMBL |
| WCK-5107 | ChEMBL |
| WCK5107 | ChEMBL |
| Zidebactam, (-)- | ChEMBL |
| Citations |
|---|