EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H22N4O3 |
| Net Charge | 0 |
| Average Mass | 438.487 |
| Monoisotopic Mass | 438.16919 |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(C(=O)O)cc3)cn([C@@H](C)c3ccccn3)c2c1 |
| InChI | InChI=1S/C26H22N4O3/c1-15-24(17(3)33-29-15)20-12-23-25(28-13-20)21(18-7-9-19(10-8-18)26(31)32)14-30(23)16(2)22-6-4-5-11-27-22/h4-14,16H,1-3H3,(H,31,32)/t16-/m0/s1 |
| InChIKey | AMSUHYUVOVCWTP-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plx-51107 (CHEBI:757701) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| Brd4 inhibitor plx51107 | ChEMBL |
| Plx 51107 | ChEMBL |
| PLX-51107 | ChEMBL |
| Citations |
|---|