EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24Cl2N4O4 |
| Net Charge | 0 |
| Average Mass | 503.386 |
| Monoisotopic Mass | 502.11746 |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-4-20(31)28-16-7-8-34-12-17(16)30-24-27-11-14-9-13(5-6-15(14)29-24)21-22(25)18(32-2)10-19(33-3)23(21)26/h4-6,9-11,16-17H,1,7-8,12H2,2-3H3,(H,28,31)(H,27,29,30)/t16-,17+/m0/s1 |
| InChIKey | MGZKYOAQVGSSGC-DLBZAZTESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisogatinib (CHEBI:757699) has role antineoplastic agent (CHEBI:35610) |
| fisogatinib (CHEBI:757699) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| fisogatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BLU-111362 | ChEMBL |
| BLU111362 | ChEMBL |
| BLU-554 | ChEMBL |
| X-439161 | ChEMBL |
| X439161 | ChEMBL |
| Citations |
|---|