EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2O3 |
| Net Charge | 0 |
| Average Mass | 330.428 |
| Monoisotopic Mass | 330.19434 |
| SMILES | COc1ccc2nc(C(=O)N3CCC(CC(C)(C)O)CC3)cc2c1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,23)12-13-6-8-21(9-7-13)18(22)17-11-14-10-15(24-3)4-5-16(14)20-17/h4-5,10-11,13,20,23H,6-9,12H2,1-3H3 |
| InChIKey | OXSCPDKUZWPWFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asp-9521 (CHEBI:757698) has role antineoplastic agent (CHEBI:35610) |
| asp-9521 (CHEBI:757698) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| Asp-9521 | ChEMBL |
| Asp9521 | ChEMBL |
| ASP 9521 | ChEMBL |
| Citations |
|---|