EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H30Cl2FNO3 |
| Net Charge | 0 |
| Average Mass | 554.489 |
| Monoisotopic Mass | 553.15868 |
| SMILES | O=C(O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(O[C@H]2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C31H30Cl2FNO3/c32-23-8-12-27(29(33)18-23)28-4-1-3-21-17-22(31(36)37)7-11-26(21)30(28)20-5-9-24(10-6-20)38-25-13-16-35(19-25)15-2-14-34/h5-12,17-18,25H,1-4,13-16,19H2,(H,36,37)/t25-/m0/s1 |
| InChIKey | KISZAGQTIXIVAR-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amcenestrant (CHEBI:757695) has role antineoplastic agent (CHEBI:35610) |
| amcenestrant (CHEBI:757695) is a diarylheptanoid (CHEBI:78802) |
| INN | Source |
|---|---|
| amcenestrant | WHO MedNet |
| Synonyms | Source |
|---|---|
| SAR-439859 | ChEMBL |
| SAR439859 | ChEMBL |
| Citations |
|---|