EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H23F6NO6S |
| Net Charge | 0 |
| Average Mass | 603.537 |
| Monoisotopic Mass | 603.11503 |
| SMILES | CC(C)(C[C@H]1CN(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2cc(-c3cc(F)cc(OC(F)F)c3)ccc2O1)C(=O)O |
| InChI | InChI=1S/C27H23F6NO6S/c1-26(2,24(35)36)13-20-14-34(41(37,38)21-5-3-4-17(11-21)27(31,32)33)22-10-15(6-7-23(22)39-20)16-8-18(28)12-19(9-16)40-25(29)30/h3-12,20,25H,13-14H2,1-2H3,(H,35,36)/t20-/m0/s1 |
| InChIKey | GULSIMHVQYBADX-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cintirorgon (CHEBI:757693) has role antineoplastic agent (CHEBI:35610) |
| cintirorgon (CHEBI:757693) is a benzoxazine (CHEBI:46969) |
| Synonyms | Source |
|---|---|
| Cintirorgon | ChEMBL |
| Lyc-55716 | ChEMBL |
| Citations |
|---|