EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24ClFN4O9P2 |
| Net Charge | 0 |
| Average Mass | 580.830 |
| Monoisotopic Mass | 580.06911 |
| SMILES | C[C@H](Nc1cc(Cl)nc2c1cnn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1F |
| InChI | InChI=1S/C20H24ClFN4O9P2/c1-10(11-4-2-3-5-13(11)22)24-14-6-16(21)25-19-12(14)7-23-26(19)20-18(28)17(27)15(35-20)8-34-37(32,33)9-36(29,30)31/h2-7,10,15,17-18,20,27-28H,8-9H2,1H3,(H,24,25)(H,32,33)(H2,29,30,31)/t10-,15+,17+,18+,20+/m0/s1 |
| InChIKey | MFYLCAMJNGIULC-KCVUFLITSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quemliclustat (CHEBI:757692) has role antineoplastic agent (CHEBI:35610) |
| quemliclustat (CHEBI:757692) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| quemliclustat | WHO MedNet |
| Synonyms | Source |
|---|---|
| AB-680 | ChEMBL |
| AB680 | ChEMBL |
| Citations |
|---|