EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N6O3 |
| Net Charge | 0 |
| Average Mass | 498.587 |
| Monoisotopic Mass | 498.23794 |
| SMILES | Cc1cc(-c2cnn3c(NC[C@H]4C[C@@](C)(O)C4)cc(Oc4cccnc4)nc23)ccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C28H30N6O3/c1-17-10-19(5-8-22(17)27(35)32-20-6-7-20)23-16-31-34-24(30-14-18-12-28(2,36)13-18)11-25(33-26(23)34)37-21-4-3-9-29-15-21/h3-5,8-11,15-16,18,20,30,36H,6-7,12-14H2,1-2H3,(H,32,35)/t18-,28+ |
| InChIKey | PMQUGSPFUBGJCZ-CHOKWEPUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luvixasertib (CHEBI:757690) has role antineoplastic agent (CHEBI:35610) |
| luvixasertib (CHEBI:757690) is a pyrazoles (CHEBI:26410) |
| luvixasertib (CHEBI:757690) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| luvixasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CFI-402257 | ChEMBL |
| CFI402257 | ChEMBL |
| Citations |
|---|