EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N5O3S |
| Net Charge | 0 |
| Average Mass | 439.541 |
| Monoisotopic Mass | 439.16781 |
| SMILES | Cc1ccc2nc(N3CCS(=O)(=O)c4ccccc4C3)nc(NCC3(N)COC3)c2c1 |
| InChI | InChI=1S/C22H25N5O3S/c1-15-6-7-18-17(10-15)20(24-12-22(23)13-30-14-22)26-21(25-18)27-8-9-31(28,29)19-5-3-2-4-16(19)11-27/h2-7,10H,8-9,11-14,23H2,1H3,(H,24,25,26) |
| InChIKey | GAAICKUTDBZCMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziresovir (CHEBI:757689) has role antiviral agent (CHEBI:22587) |
| ziresovir (CHEBI:757689) is a benzothiazepine (CHEBI:48684) |
| INN | Source |
|---|---|
| ziresovir | WHO MedNet |
| Synonyms | Source |
|---|---|
| AK-0529 | ChEMBL |
| AK0529 | ChEMBL |
| RO-0529 | ChEMBL |
| Citations |
|---|