EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N6O3 |
| Net Charge | 0 |
| Average Mass | 452.559 |
| Monoisotopic Mass | 452.25359 |
| SMILES | CC(=O)N1CCC(Nc2cc(C(=O)NC[C@H](O)CN3CCc4ccccc4C3)ncn2)CC1 |
| InChI | InChI=1S/C24H32N6O3/c1-17(31)30-10-7-20(8-11-30)28-23-12-22(26-16-27-23)24(33)25-13-21(32)15-29-9-6-18-4-2-3-5-19(18)14-29/h2-5,12,16,20-21,32H,6-11,13-15H2,1H3,(H,25,33)(H,26,27,28)/t21-/m0/s1 |
| InChIKey | JLCCNYVTIWRPIZ-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemrametostat (CHEBI:757685) has role antineoplastic agent (CHEBI:35610) |
| pemrametostat (CHEBI:757685) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| pemrametostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| EPZ-015938 | ChEMBL |
| EPZ015938 | ChEMBL |
| Gsk 3326595 | ChEMBL |
| Gsk-3326595 | ChEMBL |
| GSK3326595 | ChEMBL |
| GSK-3326595A | ChEMBL |
| Citations |
|---|