EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N4O5S |
| Net Charge | 0 |
| Average Mass | 314.323 |
| Monoisotopic Mass | 314.06849 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)[O-])[C@](C)(Cn1cc[n+](C)n1)S2(=O)=O |
| InChI | InChI=1S/C11H14N4O5S/c1-11(6-14-4-3-13(2)12-14)9(10(17)18)15-7(16)5-8(15)21(11,19)20/h3-4,8-9H,5-6H2,1-2H3/t8-,9+,11+/m1/s1 |
| InChIKey | HFZITXBUTWITPT-YWVKMMECSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enmetazobactam (CHEBI:757682) has role antibacterial agent (CHEBI:33282) |
| enmetazobactam (CHEBI:757682) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| AAI-101 | ChEMBL |
| AAI101 | ChEMBL |
| Enmetazobactam | ChEMBL |
| OCID-5090 | ChEMBL |
| Brand Name | Source |
|---|---|
| Enmetazobactam component of exblifep | ChEMBL |
| Citations |
|---|