EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24F5N5O3 |
| Net Charge | 0 |
| Average Mass | 561.511 |
| Monoisotopic Mass | 561.17993 |
| SMILES | COc1ccc(Oc2cc(NCCC(F)(F)F)c3ncc(-c4ccc(C(=O)NC5CC5)c(C)c4)n3n2)c(F)c1F |
| InChI | InChI=1S/C27H24F5N5O3/c1-14-11-15(3-6-17(14)26(38)35-16-4-5-16)19-13-34-25-18(33-10-9-27(30,31)32)12-22(36-37(19)25)40-21-8-7-20(39-2)23(28)24(21)29/h3,6-8,11-13,16,33H,4-5,9-10H2,1-2H3,(H,35,38) |
| InChIKey | WNEILUNVMHVMPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bay-1217389 (CHEBI:757679) has role antineoplastic agent (CHEBI:35610) |
| bay-1217389 (CHEBI:757679) is a imidazoles (CHEBI:24780) |
| Synonym | Source |
|---|---|
| BAY-1217389 | ChEMBL |
| Citations |
|---|