EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757678 - londamocitinib
| Formula | C28H31F2N7O4S |
| Net Charge | 0 |
| Average Mass | 599.664 |
| Monoisotopic Mass | 599.21263 |
| SMILES | COC[C@H](C(=O)Nc1cccc2c(-c3nc(Nc4cccc(S(C)(=O)=O)c4F)ncc3F)cnc12)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H31F2N7O4S/c1-36-10-12-37(13-11-36)22(16-41-2)27(38)33-21-8-4-6-17-18(14-31-26(17)21)25-19(29)15-32-28(35-25)34-20-7-5-9-23(24(20)30)42(3,39)40/h4-9,14-15,22,31H,10-13,16H2,1-3H3,(H,33,38)(H,32,34,35)/t22-/m1/s1 |
| InChIKey | JNUZADQZHYFJGW-JOCHJYFZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| londamocitinib (CHEBI:757678) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| londamocitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd4604 | ChEMBL |
| AZD-4604 | ChEMBL |
| Citations |
|---|