EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H41ClN2O5S |
| Net Charge | 0 |
| Average Mass | 613.220 |
| Monoisotopic Mass | 612.24247 |
| SMILES | [H][C@@]12CC[C@@]1([H])[C@@H](OC)/C=C/C[C@H](C)[C@@H](C)S(=O)(=O)NC(=O)c1ccc3c(c1)N(C[C@@]1(CCCc4cc(Cl)ccc41)CO3)C2 |
| InChI | InChI=1S/C33H41ClN2O5S/c1-21-6-4-8-30(40-3)27-12-9-25(27)18-36-19-33(15-5-7-23-16-26(34)11-13-28(23)33)20-41-31-14-10-24(17-29(31)36)32(37)35-42(38,39)22(21)2/h4,8,10-11,13-14,16-17,21-22,25,27,30H,5-7,9,12,15,18-20H2,1-3H3,(H,35,37)/b8-4+/t21-,22+,25-,27+,30-,33-/m0/s1 |
| InChIKey | JQNINBDKGLWYMU-GEAQBIRJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tapotoclax (CHEBI:757677) has role antineoplastic agent (CHEBI:35610) |
| tapotoclax (CHEBI:757677) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| tapotoclax | WHO MedNet |
| Synonyms | Source |
|---|---|
| AMG 176 | ChEMBL |
| AMG-176 | ChEMBL |
| AMG176 | ChEMBL |
| Mcl-1 inhibitor amg 176 | ChEMBL |
| Mcl-1 inhibitor amg-176 | ChEMBL |
| Citations |
|---|