EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27F2N5O4S |
| Net Charge | 0 |
| Average Mass | 471.530 |
| Monoisotopic Mass | 471.17518 |
| SMILES | C[C@@]1(O)CCC[C@H]1n1c(=O)c(C(F)F)cc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc21 |
| InChI | InChI=1S/C20H27F2N5O4S/c1-20(29)7-3-4-15(20)27-17-12(10-14(16(21)22)18(27)28)11-23-19(25-17)24-13-5-8-26(9-6-13)32(2,30)31/h10-11,13,15-16,29H,3-9H2,1-2H3,(H,23,24,25)/t15-,20-/m1/s1 |
| InChIKey | QIEKHLDZKRQLLN-FOIQADDNSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ebvaciclib (CHEBI:757676) has role antineoplastic agent (CHEBI:35610) |
| ebvaciclib (CHEBI:757676) is a pyridopyrimidine (CHEBI:38932) |
| INN | Source |
|---|---|
| ebvaciclib | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-06873600 | ChEMBL |
| Citations |
|---|