EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F3N4O3S |
| Net Charge | 0 |
| Average Mass | 430.452 |
| Monoisotopic Mass | 430.12865 |
| SMILES | C[C@@H](O)[C@@H](C)Oc1nc(Nc2ccc(S(=N)(=O)C3CC3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O3S/c1-10(26)11(2)28-16-15(18(19,20)21)9-23-17(25-16)24-12-3-5-13(6-4-12)29(22,27)14-7-8-14/h3-6,9-11,14,22,26H,7-8H2,1-2H3,(H,23,24,25)/t10-,11-,29?/m1/s1 |
| InChIKey | UELYDGOOJPRWGF-MFOHZAOFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roniciclib (CHEBI:757674) has role antineoplastic agent (CHEBI:35610) |
| roniciclib (CHEBI:757674) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| roniciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bay 1000394 | ChEMBL |
| Bay-1000394 | ChEMBL |
| BAY10-00394 | ChEMBL |
| BAY1000394 | ChEMBL |
| Citations |
|---|