EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18FN5O2S |
| Net Charge | 0 |
| Average Mass | 387.440 |
| Monoisotopic Mass | 387.11652 |
| SMILES | COc1cc(F)ccc1-c1ncnc(Nc2cccc(C[S@](C)(=N)=O)c2)n1 |
| InChI | InChI=1S/C18H18FN5O2S/c1-26-16-9-13(19)6-7-15(16)17-21-11-22-18(24-17)23-14-5-3-4-12(8-14)10-27(2,20)25/h3-9,11,20H,10H2,1-2H3,(H,21,22,23,24)/t27-/m1/s1 |
| InChIKey | ACWKGTGIJRCOOM-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atuveciclib (CHEBI:757673) has role antineoplastic agent (CHEBI:35610) |
| atuveciclib (CHEBI:757673) is a methoxybenzenes (CHEBI:51683) |
| INN | Source |
|---|---|
| atuveciclib | WHO MedNet |
| Citations |
|---|