EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N8O2 |
| Net Charge | 0 |
| Average Mass | 380.412 |
| Monoisotopic Mass | 380.17092 |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(n1)n(C1CCOCC1)c(=O)n2C |
| InChI | InChI=1S/C18H20N8O2/c1-11-7-15-20-10-21-25(15)9-13(11)22-17-19-8-14-16(23-17)26(18(27)24(14)2)12-3-5-28-6-4-12/h7-10,12H,3-6H2,1-2H3,(H,19,22,23) |
| InChIKey | XISVSTPEXYIKJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-7648 (CHEBI:757672) has role antineoplastic agent (CHEBI:35610) |
| azd-7648 (CHEBI:757672) is a oxopurine (CHEBI:25810) |
| Synonyms | Source |
|---|---|
| AZD-7648 | ChEMBL |
| AZD7648 | ChEMBL |
| Citations |
|---|