EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15ClN8 |
| Net Charge | 0 |
| Average Mass | 390.838 |
| Monoisotopic Mass | 390.11082 |
| SMILES | C[C@H](Nc1ncnc(N)c1C#N)c1cc2ncc(Cl)n2nc1-c1ccccc1 |
| InChI | InChI=1S/C19H15ClN8/c1-11(26-19-14(8-21)18(22)24-10-25-19)13-7-16-23-9-15(20)28(16)27-17(13)12-5-3-2-4-6-12/h2-7,9-11H,1H3,(H3,22,24,25,26)/t11-/m0/s1 |
| InChIKey | WKDBRCUUDXLTIM-NSHDSACASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amdizalisib (CHEBI:757670) has role antineoplastic agent (CHEBI:35610) |
| amdizalisib (CHEBI:757670) is a pyridazines (CHEBI:37921) |
| amdizalisib (CHEBI:757670) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Amdizalisib | ChEMBL |
| HMPL-689 | ChEMBL |
| Citations |
|---|