EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757669 - rilematovir
| Formula | C21H20ClF3N4O3S |
| Net Charge | 0 |
| Average Mass | 500.930 |
| Monoisotopic Mass | 500.08967 |
| SMILES | CS(=O)(=O)CCCn1c(Cn2c(=O)n(CC(F)(F)F)c3ccncc32)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H20ClF3N4O3S/c1-33(31,32)8-2-7-27-16(10-14-9-15(22)3-4-17(14)27)12-28-19-11-26-6-5-18(19)29(20(28)30)13-21(23,24)25/h3-6,9-11H,2,7-8,12-13H2,1H3 |
| InChIKey | GTQTUABHRCWVLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rilematovir (CHEBI:757669) has role antiinfective agent (CHEBI:35441) |
| rilematovir (CHEBI:757669) has role antiviral agent (CHEBI:22587) |
| rilematovir (CHEBI:757669) is a imidazopyridine (CHEBI:46908) |
| INN | Source |
|---|---|
| rilematovir | WHO MedNet |
| Synonym | Source |
|---|---|
| Jnj-53718678 | ChEMBL |
| Citations |
|---|