EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19D3N8O3 |
| Net Charge | 0 |
| Average Mass | 425.467 |
| Monoisotopic Mass | 425.20032 |
| SMILES | [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncn(C)n2)c1OC |
| InChI | InChI=1S/C20H22N8O3/c1-21-20(30)16-14(9-15(25-26-16)24-19(29)11-7-8-11)23-13-6-4-5-12(17(13)31-3)18-22-10-28(2)27-18/h4-6,9-11H,7-8H2,1-3H3,(H,21,30)(H2,23,24,25,29)/i1D3 |
| InChIKey | BZZKEPGENYLQSC-FIBGUPNXSA-N |
| Roles Classification |
|---|
| Applications: | antipsoriatic A drug used to treat psoriasis. anti-inflammatory agent Any compound that has anti-inflammatory effects. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deucravacitinib (CHEBI:757668) has role anti-inflammatory agent (CHEBI:67079) |
| deucravacitinib (CHEBI:757668) has role antipsoriatic (CHEBI:50748) |
| deucravacitinib (CHEBI:757668) has role renoprotective agent (CHEBI:231911) |
| deucravacitinib (CHEBI:757668) is a triazoles (CHEBI:35727) |
| Synonyms | Source |
|---|---|
| BMS-986165 | ChEMBL |
| Deucravacitinib | ChEMBL |
| Brand Name | Source |
|---|---|
| Sotyktu | ChEMBL |
| Citations |
|---|